C25H28ClN4O3+ — CID 11866424
N-[(6aS,8S)-2-(4-chlorophenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]piperidin-1-ium-4-carboxamide (PubChem CID 11866424) has the molecular formula C25H28ClN4O3+ and a molecular weight of 467.98 g/mol. Its IUPAC name is N-[(6aS,8S)-2-(4-chlorophenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]piperidin-1-ium-4-carboxamide.
| Compound Name | N-[(6aS,8S)-2-(4-chlorophenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 11866424 |
| Molecular Formula | C25H28ClN4O3+ |
| Molecular Weight | 467.98 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | N-[(6aS,8S)-2-(4-chlorophenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]piperidin-1-ium-4-carboxamide |
| SMILES | O=C(N[C@H]1CCN2C(=O)c3cc(-c4ccc(Cl)cc4)ccc3NC(=O)[C@@H]2C1)C1CC[NH2+]CC1 |
| InChI | InChI=1S/C25H27ClN4O3/c26-18-4-1-15(2-5-18)17-3-6-21-20(13-17)25(33)30-12-9-19(14-22(30)24(32)29-21)28-23(31)16-7-10-27-11-8-16/h1-6,13,16,19,22,27H,7-12,14H2,(H,28,31)(H,29,32)/p+1/t19-,22-/m0/s1 |
| InChIKey | MHNMBNWQHRVIDZ-UGKGYDQZSA-O |
| XLogP | 2.02 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.98 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |