C22H19N3O3S2 — CID 9424302
N-[(6aS,8S)-6,12-dioxo-2-thiophen-3-yl-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]thiophene-2-carboxamide (PubChem CID 9424302) has the molecular formula C22H19N3O3S2 and a molecular weight of 437.55 g/mol. Its IUPAC name is N-[(6aS,8S)-6,12-dioxo-2-thiophen-3-yl-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]thiophene-2-carboxamide.
| Compound Name | N-[(6aS,8S)-6,12-dioxo-2-thiophen-3-yl-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 9424302 |
| Molecular Formula | C22H19N3O3S2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | N-[(6aS,8S)-6,12-dioxo-2-thiophen-3-yl-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]thiophene-2-carboxamide |
| SMILES | O=C(N[C@H]1CCN2C(=O)c3cc(-c4ccsc4)ccc3NC(=O)[C@@H]2C1)c1cccs1 |
| InChI | InChI=1S/C22H19N3O3S2/c26-20-18-11-15(23-21(27)19-2-1-8-30-19)5-7-25(18)22(28)16-10-13(3-4-17(16)24-20)14-6-9-29-12-14/h1-4,6,8-10,12,15,18H,5,7,11H2,(H,23,27)(H,24,26)/t15-,18-/m0/s1 |
| InChIKey | JCSCXYLUBYNKNI-YJBOKZPZSA-N |
| XLogP | 3.83 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |