C13H15N3O3S — CID 3870730
N-(1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl)thiophene-2-carboxamide (PubChem CID 3870730) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is N-(1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl)thiophene-2-carboxamide.
| Compound Name | N-(1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 3870730 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | N-(1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl)thiophene-2-carboxamide |
| SMILES | O=C(NC1CCN2C(=O)CNC(=O)C2C1)c1cccs1 |
| InChI | InChI=1S/C13H15N3O3S/c17-11-7-14-12(18)9-6-8(3-4-16(9)11)15-13(19)10-2-1-5-20-10/h1-2,5,8-9H,3-4,6-7H2,(H,14,18)(H,15,19) |
| InChIKey | VCKIYVVRYSASJX-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |