C21H26N4O4S — CID 11865922
N-[(3S,7S,10R,12S)-4-(cyclopentanecarbonyl)-2,9-dioxo-1,4,8-triazatricyclo[8.3.0.03,7]tridecan-12-yl]thiophene-2-carboxamide (PubChem CID 11865922) has the molecular formula C21H26N4O4S and a molecular weight of 430.53 g/mol. Its IUPAC name is N-[(3S,7S,10R,12S)-4-(cyclopentanecarbonyl)-2,9-dioxo-1,4,8-triazatricyclo[8.3.0.03,7]tridecan-12-yl]thiophene-2-carboxamide.
| Compound Name | N-[(3S,7S,10R,12S)-4-(cyclopentanecarbonyl)-2,9-dioxo-1,4,8-triazatricyclo[8.3.0.03,7]tridecan-12-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 11865922 |
| Molecular Formula | C21H26N4O4S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | N-[(3S,7S,10R,12S)-4-(cyclopentanecarbonyl)-2,9-dioxo-1,4,8-triazatricyclo[8.3.0.03,7]tridecan-12-yl]thiophene-2-carboxamide |
| SMILES | O=C(N[C@H]1C[C@@H]2C(=O)N[C@H]3CCN(C(=O)C4CCCC4)[C@@H]3C(=O)N2C1)c1cccs1 |
| InChI | InChI=1S/C21H26N4O4S/c26-18-15-10-13(22-19(27)16-6-3-9-30-16)11-25(15)21(29)17-14(23-18)7-8-24(17)20(28)12-4-1-2-5-12/h3,6,9,12-15,17H,1-2,4-5,7-8,10-11H2,(H,22,27)(H,23,26)/t13-,14-,15+,17-/m0/s1 |
| InChIKey | GDPKJBJIWIVWDU-MPTYRVRUSA-N |
| XLogP | 0.74 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |