C18H22N4O4S — CID 11865976
N-[(3S,7S,10R,12S)-4-acetyl-2,9-dioxo-1,4,8-triazatricyclo[8.3.0.03,7]tridecan-12-yl]-2-thiophen-2-ylacetamide (PubChem CID 11865976) has the molecular formula C18H22N4O4S and a molecular weight of 390.47 g/mol. Its IUPAC name is N-[(3S,7S,10R,12S)-4-acetyl-2,9-dioxo-1,4,8-triazatricyclo[8.3.0.03,7]tridecan-12-yl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[(3S,7S,10R,12S)-4-acetyl-2,9-dioxo-1,4,8-triazatricyclo[8.3.0.03,7]tridecan-12-yl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 11865976 |
| Molecular Formula | C18H22N4O4S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | N-[(3S,7S,10R,12S)-4-acetyl-2,9-dioxo-1,4,8-triazatricyclo[8.3.0.03,7]tridecan-12-yl]-2-thiophen-2-ylacetamide |
| SMILES | CC(=O)N1CC[C@@H]2NC(=O)[C@H]3C[C@H](NC(=O)Cc4cccs4)CN3C(=O)[C@H]21 |
| InChI | InChI=1S/C18H22N4O4S/c1-10(23)21-5-4-13-16(21)18(26)22-9-11(7-14(22)17(25)20-13)19-15(24)8-12-3-2-6-27-12/h2-3,6,11,13-14,16H,4-5,7-9H2,1H3,(H,19,24)(H,20,25)/t11-,13-,14+,16-/m0/s1 |
| InChIKey | AFZPGYDPTBGNNI-ZIEJDFEHSA-N |
| XLogP | -0.50 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |