C21H26N4O6 — CID 11865917
N-[(3S,7S,10R,12S)-4-[(2S)-2-hydroxy-2-phenylacetyl]-2,9-dioxo-1,4,8-triazatricyclo[8.3.0.03,7]tridecan-12-yl]-2-methoxyacetamide (PubChem CID 11865917) has the molecular formula C21H26N4O6 and a molecular weight of 430.46 g/mol. Its IUPAC name is N-[(3S,7S,10R,12S)-4-[(2S)-2-hydroxy-2-phenylacetyl]-2,9-dioxo-1,4,8-triazatricyclo[8.3.0.03,7]tridecan-12-yl]-2-methoxyacetamide.
| Compound Name | N-[(3S,7S,10R,12S)-4-[(2S)-2-hydroxy-2-phenylacetyl]-2,9-dioxo-1,4,8-triazatricyclo[8.3.0.03,7]tridecan-12-yl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 11865917 |
| Molecular Formula | C21H26N4O6 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | N-[(3S,7S,10R,12S)-4-[(2S)-2-hydroxy-2-phenylacetyl]-2,9-dioxo-1,4,8-triazatricyclo[8.3.0.03,7]tridecan-12-yl]-2-methoxyacetamide |
| SMILES | COCC(=O)N[C@H]1C[C@@H]2C(=O)N[C@H]3CCN(C(=O)[C@@H](O)c4ccccc4)[C@@H]3C(=O)N2C1 |
| InChI | InChI=1S/C21H26N4O6/c1-31-11-16(26)22-13-9-15-19(28)23-14-7-8-24(17(14)20(29)25(15)10-13)21(30)18(27)12-5-3-2-4-6-12/h2-6,13-15,17-18,27H,7-11H2,1H3,(H,22,26)(H,23,28)/t13-,14-,15+,17-,18-/m0/s1 |
| InChIKey | QRTQYGUYBPXBQQ-HITLURFISA-N |
| XLogP | -1.45 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |