C24H27N5O5 — CID 162801705
N-[(3S,7R,10S,12R)-4-[(2S)-2-hydroxy-2-phenylacetyl]-2,9-dioxo-1,4,8-triazatricyclo[8.3.0.03,7]tridecan-12-yl]-1-methylpyrrole-2-carboxamide (PubChem CID 162801705) has the molecular formula C24H27N5O5 and a molecular weight of 465.51 g/mol. Its IUPAC name is N-[(3S,7R,10S,12R)-4-[(2S)-2-hydroxy-2-phenylacetyl]-2,9-dioxo-1,4,8-triazatricyclo[8.3.0.03,7]tridecan-12-yl]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[(3S,7R,10S,12R)-4-[(2S)-2-hydroxy-2-phenylacetyl]-2,9-dioxo-1,4,8-triazatricyclo[8.3.0.03,7]tridecan-12-yl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 162801705 |
| Molecular Formula | C24H27N5O5 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | N-[(3S,7R,10S,12R)-4-[(2S)-2-hydroxy-2-phenylacetyl]-2,9-dioxo-1,4,8-triazatricyclo[8.3.0.03,7]tridecan-12-yl]-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cccc1C(=O)N[C@@H]1C[C@H]2C(=O)N[C@@H]3CCN(C(=O)[C@@H](O)c4ccccc4)[C@@H]3C(=O)N2C1 |
| InChI | InChI=1S/C24H27N5O5/c1-27-10-5-8-17(27)21(31)25-15-12-18-22(32)26-16-9-11-28(19(16)23(33)29(18)13-15)24(34)20(30)14-6-3-2-4-7-14/h2-8,10,15-16,18-20,30H,9,11-13H2,1H3,(H,25,31)(H,26,32)/t15-,16-,18+,19+,20+/m1/s1 |
| InChIKey | JCVGWYNZQKEWFM-CJGGRQNCSA-N |
| XLogP | -0.44 |
| TPSA | 123.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |