C22H31N5O4 — CID 11865960
N-[(3S,7S,10R,12S)-4-(3,3-dimethylbutanoyl)-2,9-dioxo-1,4,8-triazatricyclo[8.3.0.03,7]tridecan-12-yl]-1-methylpyrrole-2-carboxamide (PubChem CID 11865960) has the molecular formula C22H31N5O4 and a molecular weight of 429.52 g/mol. Its IUPAC name is N-[(3S,7S,10R,12S)-4-(3,3-dimethylbutanoyl)-2,9-dioxo-1,4,8-triazatricyclo[8.3.0.03,7]tridecan-12-yl]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[(3S,7S,10R,12S)-4-(3,3-dimethylbutanoyl)-2,9-dioxo-1,4,8-triazatricyclo[8.3.0.03,7]tridecan-12-yl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 11865960 |
| Molecular Formula | C22H31N5O4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | N-[(3S,7S,10R,12S)-4-(3,3-dimethylbutanoyl)-2,9-dioxo-1,4,8-triazatricyclo[8.3.0.03,7]tridecan-12-yl]-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cccc1C(=O)N[C@H]1C[C@@H]2C(=O)N[C@H]3CCN(C(=O)CC(C)(C)C)[C@@H]3C(=O)N2C1 |
| InChI | InChI=1S/C22H31N5O4/c1-22(2,3)11-17(28)26-9-7-14-18(26)21(31)27-12-13(10-16(27)20(30)24-14)23-19(29)15-6-5-8-25(15)4/h5-6,8,13-14,16,18H,7,9-12H2,1-4H3,(H,23,29)(H,24,30)/t13-,14-,16+,18-/m0/s1 |
| InChIKey | KTUKXRKCCZNLEK-KMCQBPLKSA-N |
| XLogP | 0.26 |
| TPSA | 103.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |