C20H24N4O4S — CID 11865880
N-[(3S,7S,10R,12S)-4-(2-methylsulfanylacetyl)-2,9-dioxo-1,4,8-triazatricyclo[8.3.0.03,7]tridecan-12-yl]benzamide (PubChem CID 11865880) has the molecular formula C20H24N4O4S and a molecular weight of 416.50 g/mol. Its IUPAC name is N-[(3S,7S,10R,12S)-4-(2-methylsulfanylacetyl)-2,9-dioxo-1,4,8-triazatricyclo[8.3.0.03,7]tridecan-12-yl]benzamide.
| Compound Name | N-[(3S,7S,10R,12S)-4-(2-methylsulfanylacetyl)-2,9-dioxo-1,4,8-triazatricyclo[8.3.0.03,7]tridecan-12-yl]benzamide |
|---|---|
| PubChem CID | 11865880 |
| Molecular Formula | C20H24N4O4S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | N-[(3S,7S,10R,12S)-4-(2-methylsulfanylacetyl)-2,9-dioxo-1,4,8-triazatricyclo[8.3.0.03,7]tridecan-12-yl]benzamide |
| SMILES | CSCC(=O)N1CC[C@@H]2NC(=O)[C@H]3C[C@H](NC(=O)c4ccccc4)CN3C(=O)[C@H]21 |
| InChI | InChI=1S/C20H24N4O4S/c1-29-11-16(25)23-8-7-14-17(23)20(28)24-10-13(9-15(24)19(27)22-14)21-18(26)12-5-3-2-4-6-12/h2-6,13-15,17H,7-11H2,1H3,(H,21,26)(H,22,27)/t13-,14-,15+,17-/m0/s1 |
| InChIKey | WWHOOTYUIPYDBL-MPTYRVRUSA-N |
| XLogP | -0.15 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |