C24H26N4O5S — CID 11865954
N-[(3S,7S,10R,12S)-2,9-dioxo-4-(thiophene-2-carbonyl)-1,4,8-triazatricyclo[8.3.0.03,7]tridecan-12-yl]-2-(2-methoxyphenyl)acetamide (PubChem CID 11865954) has the molecular formula C24H26N4O5S and a molecular weight of 482.56 g/mol. Its IUPAC name is N-[(3S,7S,10R,12S)-2,9-dioxo-4-(thiophene-2-carbonyl)-1,4,8-triazatricyclo[8.3.0.03,7]tridecan-12-yl]-2-(2-methoxyphenyl)acetamide.
| Compound Name | N-[(3S,7S,10R,12S)-2,9-dioxo-4-(thiophene-2-carbonyl)-1,4,8-triazatricyclo[8.3.0.03,7]tridecan-12-yl]-2-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 11865954 |
| Molecular Formula | C24H26N4O5S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | N-[(3S,7S,10R,12S)-2,9-dioxo-4-(thiophene-2-carbonyl)-1,4,8-triazatricyclo[8.3.0.03,7]tridecan-12-yl]-2-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1CC(=O)N[C@H]1C[C@@H]2C(=O)N[C@H]3CCN(C(=O)c4cccs4)[C@@H]3C(=O)N2C1 |
| InChI | InChI=1S/C24H26N4O5S/c1-33-18-6-3-2-5-14(18)11-20(29)25-15-12-17-22(30)26-16-8-9-27(21(16)24(32)28(17)13-15)23(31)19-7-4-10-34-19/h2-7,10,15-17,21H,8-9,11-13H2,1H3,(H,25,29)(H,26,30)/t15-,16-,17+,21-/m0/s1 |
| InChIKey | LUQKHIOYUWQNNN-OPOADAIRSA-N |
| XLogP | 0.80 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |