C25H28N4O4S — CID 11865979
N-[(3S,7S,10R,12S)-4-(2,5-dimethylbenzoyl)-2,9-dioxo-1,4,8-triazatricyclo[8.3.0.03,7]tridecan-12-yl]-2-thiophen-2-ylacetamide (PubChem CID 11865979) has the molecular formula C25H28N4O4S and a molecular weight of 480.59 g/mol. Its IUPAC name is N-[(3S,7S,10R,12S)-4-(2,5-dimethylbenzoyl)-2,9-dioxo-1,4,8-triazatricyclo[8.3.0.03,7]tridecan-12-yl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[(3S,7S,10R,12S)-4-(2,5-dimethylbenzoyl)-2,9-dioxo-1,4,8-triazatricyclo[8.3.0.03,7]tridecan-12-yl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 11865979 |
| Molecular Formula | C25H28N4O4S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | N-[(3S,7S,10R,12S)-4-(2,5-dimethylbenzoyl)-2,9-dioxo-1,4,8-triazatricyclo[8.3.0.03,7]tridecan-12-yl]-2-thiophen-2-ylacetamide |
| SMILES | Cc1ccc(C)c(C(=O)N2CC[C@@H]3NC(=O)[C@H]4C[C@H](NC(=O)Cc5cccs5)CN4C(=O)[C@H]32)c1 |
| InChI | InChI=1S/C25H28N4O4S/c1-14-5-6-15(2)18(10-14)24(32)28-8-7-19-22(28)25(33)29-13-16(11-20(29)23(31)27-19)26-21(30)12-17-4-3-9-34-17/h3-6,9-10,16,19-20,22H,7-8,11-13H2,1-2H3,(H,26,30)(H,27,31)/t16-,19-,20+,22-/m0/s1 |
| InChIKey | GELHQLWRPKURIT-IBHRTIHJSA-N |
| XLogP | 1.41 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |