C24H19F2N3O3S — CID 28963221
N-[(6aS,8S)-2-(2,4-difluorophenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]thiophene-2-carboxamide (PubChem CID 28963221) has the molecular formula C24H19F2N3O3S and a molecular weight of 467.50 g/mol. Its IUPAC name is N-[(6aS,8S)-2-(2,4-difluorophenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]thiophene-2-carboxamide.
| Compound Name | N-[(6aS,8S)-2-(2,4-difluorophenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 28963221 |
| Molecular Formula | C24H19F2N3O3S |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | N-[(6aS,8S)-2-(2,4-difluorophenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]thiophene-2-carboxamide |
| SMILES | O=C(N[C@H]1CCN2C(=O)c3cc(-c4ccc(F)cc4F)ccc3NC(=O)[C@@H]2C1)c1cccs1 |
| InChI | InChI=1S/C24H19F2N3O3S/c25-14-4-5-16(18(26)11-14)13-3-6-19-17(10-13)24(32)29-8-7-15(12-20(29)22(30)28-19)27-23(31)21-2-1-9-33-21/h1-6,9-11,15,20H,7-8,12H2,(H,27,31)(H,28,30)/t15-,20-/m0/s1 |
| InChIKey | NXBRCTNHSBMCSF-YWZLYKJASA-N |
| XLogP | 4.05 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |