C20H18FN3O3 — CID 11943248
N-[(6aS,8S)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-3-fluorobenzamide (PubChem CID 11943248) has the molecular formula C20H18FN3O3 and a molecular weight of 367.38 g/mol. Its IUPAC name is N-[(6aS,8S)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-3-fluorobenzamide.
| Compound Name | N-[(6aS,8S)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 11943248 |
| Molecular Formula | C20H18FN3O3 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | N-[(6aS,8S)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-3-fluorobenzamide |
| SMILES | O=C(N[C@H]1CCN2C(=O)c3ccccc3NC(=O)[C@@H]2C1)c1cccc(F)c1 |
| InChI | InChI=1S/C20H18FN3O3/c21-13-5-3-4-12(10-13)18(25)22-14-8-9-24-17(11-14)19(26)23-16-7-2-1-6-15(16)20(24)27/h1-7,10,14,17H,8-9,11H2,(H,22,25)(H,23,26)/t14-,17-/m0/s1 |
| InChIKey | DYTQLCDZNRIGIT-YOEHRIQHSA-N |
| XLogP | 2.18 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |