C21H18F3N3O3 — CID 3686367
N-(6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl)-4-(trifluoromethyl)benzamide (PubChem CID 3686367) has the molecular formula C21H18F3N3O3 and a molecular weight of 417.39 g/mol. Its IUPAC name is N-(6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl)-4-(trifluoromethyl)benzamide.
| Compound Name | N-(6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 3686367 |
| Molecular Formula | C21H18F3N3O3 |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | N-(6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl)-4-(trifluoromethyl)benzamide |
| SMILES | O=C(NC1CCN2C(=O)c3ccccc3NC(=O)C2C1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H18F3N3O3/c22-21(23,24)13-7-5-12(6-8-13)18(28)25-14-9-10-27-17(11-14)19(29)26-16-4-2-1-3-15(16)20(27)30/h1-8,14,17H,9-11H2,(H,25,28)(H,26,29) |
| InChIKey | VJJZUPPPCKILCT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |