C24H20FN3O4 — CID 73149198
N-[2-(2-fluorophenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]furan-2-carboxamide (PubChem CID 73149198) has the molecular formula C24H20FN3O4 and a molecular weight of 433.44 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]furan-2-carboxamide.
| Compound Name | N-[2-(2-fluorophenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 73149198 |
| Molecular Formula | C24H20FN3O4 |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | N-[2-(2-fluorophenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]furan-2-carboxamide |
| SMILES | O=C(NC1CCN2C(=O)c3cc(-c4ccccc4F)ccc3NC(=O)C2C1)c1ccco1 |
| InChI | InChI=1S/C24H20FN3O4/c25-18-5-2-1-4-16(18)14-7-8-19-17(12-14)24(31)28-10-9-15(13-20(28)22(29)27-19)26-23(30)21-6-3-11-32-21/h1-8,11-12,15,20H,9-10,13H2,(H,26,30)(H,27,29) |
| InChIKey | OEKZIKXGMJONAM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |