C24H21N3O4S — CID 11865863
N-[(6aS,8S)-2-(4-methylsulfanylphenyl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]furan-2-carboxamide (PubChem CID 11865863) has the molecular formula C24H21N3O4S and a molecular weight of 447.52 g/mol. Its IUPAC name is N-[(6aS,8S)-2-(4-methylsulfanylphenyl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]furan-2-carboxamide.
| Compound Name | N-[(6aS,8S)-2-(4-methylsulfanylphenyl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 11865863 |
| Molecular Formula | C24H21N3O4S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | N-[(6aS,8S)-2-(4-methylsulfanylphenyl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]furan-2-carboxamide |
| SMILES | CSc1ccc(-c2ccc3c(c2)C(=O)N2C[C@@H](NC(=O)c4ccco4)C[C@H]2C(=O)N3)cc1 |
| InChI | InChI=1S/C24H21N3O4S/c1-32-17-7-4-14(5-8-17)15-6-9-19-18(11-15)24(30)27-13-16(12-20(27)22(28)26-19)25-23(29)21-3-2-10-31-21/h2-11,16,20H,12-13H2,1H3,(H,25,29)(H,26,28)/t16-,20-/m0/s1 |
| InChIKey | PNOVCCDVHCOOHJ-JXFKEZNVSA-N |
| XLogP | 3.63 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |