C25H20N4O6 — CID 3779227
N-[2-[2-(3-nitrophenyl)ethenyl]-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]furan-2-carboxamide (PubChem CID 3779227) has the molecular formula C25H20N4O6 and a molecular weight of 472.46 g/mol. Its IUPAC name is N-[2-[2-(3-nitrophenyl)ethenyl]-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]furan-2-carboxamide.
| Compound Name | N-[2-[2-(3-nitrophenyl)ethenyl]-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3779227 |
| Molecular Formula | C25H20N4O6 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | N-[2-[2-(3-nitrophenyl)ethenyl]-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]furan-2-carboxamide |
| SMILES | O=C(NC1CC2C(=O)Nc3ccc(C=Cc4cccc([N+](=O)[O-])c4)cc3C(=O)N2C1)c1ccco1 |
| InChI | InChI=1S/C25H20N4O6/c30-23-21-13-17(26-24(31)22-5-2-10-35-22)14-28(21)25(32)19-12-16(8-9-20(19)27-23)7-6-15-3-1-4-18(11-15)29(33)34/h1-12,17,21H,13-14H2,(H,26,31)(H,27,30) |
| InChIKey | AFVGXEAAJZMYAT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 134.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|