C31H34N5O4+ — CID 7128131
N-[(6aS,8S)-2-[(E)-2-[4-(morpholin-4-ium-4-ylmethyl)phenyl]ethenyl]-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]-1-methylpyrrole-2-carboxamide (PubChem CID 7128131) has the molecular formula C31H34N5O4+ and a molecular weight of 540.64 g/mol. Its IUPAC name is N-[(6aS,8S)-2-[(E)-2-[4-(morpholin-4-ium-4-ylmethyl)phenyl]ethenyl]-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[(6aS,8S)-2-[(E)-2-[4-(morpholin-4-ium-4-ylmethyl)phenyl]ethenyl]-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 7128131 |
| Molecular Formula | C31H34N5O4+ |
| Molecular Weight | 540.64 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | N-[(6aS,8S)-2-[(E)-2-[4-(morpholin-4-ium-4-ylmethyl)phenyl]ethenyl]-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cccc1C(=O)N[C@H]1C[C@H]2C(=O)Nc3ccc(/C=C/c4ccc(C[NH+]5CCOCC5)cc4)cc3C(=O)N2C1 |
| InChI | InChI=1S/C31H33N5O4/c1-34-12-2-3-27(34)29(37)32-24-18-28-30(38)33-26-11-10-22(17-25(26)31(39)36(28)20-24)7-4-21-5-8-23(9-6-21)19-35-13-15-40-16-14-35/h2-12,17,24,28H,13-16,18-20H2,1H3,(H,32,37)(H,33,38)/p+1/b7-4+/t24-,28-/m0/s1 |
| InChIKey | NFFPQJBRJFZKFY-ZVQSXVGSSA-O |
| XLogP | 1.58 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.64 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|