C23H22N4O3S — CID 3715641
N-(6,12-dioxo-2-thiophen-2-yl-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl)-1-methylpyrrole-2-carboxamide (PubChem CID 3715641) has the molecular formula C23H22N4O3S and a molecular weight of 434.52 g/mol. Its IUPAC name is N-(6,12-dioxo-2-thiophen-2-yl-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl)-1-methylpyrrole-2-carboxamide.
| Compound Name | N-(6,12-dioxo-2-thiophen-2-yl-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl)-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 3715641 |
| Molecular Formula | C23H22N4O3S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | N-(6,12-dioxo-2-thiophen-2-yl-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl)-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cccc1C(=O)NC1CCN2C(=O)c3cc(-c4cccs4)ccc3NC(=O)C2C1 |
| InChI | InChI=1S/C23H22N4O3S/c1-26-9-2-4-18(26)21(28)24-15-8-10-27-19(13-15)22(29)25-17-7-6-14(12-16(17)23(27)30)20-5-3-11-31-20/h2-7,9,11-12,15,19H,8,10,13H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | LJRAMQSQWJNDIS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |