C23H24N3O5S- — CID 9424185
5-[[(6aS,8S)-6,11-dioxo-2-thiophen-2-yl-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]amino]-3,3-dimethyl-5-oxopentanoate (PubChem CID 9424185) has the molecular formula C23H24N3O5S- and a molecular weight of 454.53 g/mol. Its IUPAC name is 5-[[(6aS,8S)-6,11-dioxo-2-thiophen-2-yl-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]amino]-3,3-dimethyl-5-oxopentanoate.
| Compound Name | 5-[[(6aS,8S)-6,11-dioxo-2-thiophen-2-yl-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]amino]-3,3-dimethyl-5-oxopentanoate |
|---|---|
| PubChem CID | 9424185 |
| Molecular Formula | C23H24N3O5S- |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 5-[[(6aS,8S)-6,11-dioxo-2-thiophen-2-yl-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]amino]-3,3-dimethyl-5-oxopentanoate |
| SMILES | CC(C)(CC(=O)[O-])CC(=O)N[C@H]1C[C@H]2C(=O)Nc3ccc(-c4cccs4)cc3C(=O)N2C1 |
| InChI | InChI=1S/C23H25N3O5S/c1-23(2,11-20(28)29)10-19(27)24-14-9-17-21(30)25-16-6-5-13(18-4-3-7-32-18)8-15(16)22(31)26(17)12-14/h3-8,14,17H,9-12H2,1-2H3,(H,24,27)(H,25,30)(H,28,29)/p-1/t14-,17-/m0/s1 |
| InChIKey | WKYIPGAEYDGMBU-YOEHRIQHSA-M |
| XLogP | 1.62 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |