C25H21N3O5S — CID 5019962
N-[2-(1,3-benzodioxol-5-yl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]-2-thiophen-2-ylacetamide (PubChem CID 5019962) has the molecular formula C25H21N3O5S and a molecular weight of 475.53 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 5019962 |
| Molecular Formula | C25H21N3O5S |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)NC1CC2C(=O)Nc3ccc(-c4ccc5c(c4)OCO5)cc3C(=O)N2C1 |
| InChI | InChI=1S/C25H21N3O5S/c29-23(11-17-2-1-7-34-17)26-16-10-20-24(30)27-19-5-3-14(8-18(19)25(31)28(20)12-16)15-4-6-21-22(9-15)33-13-32-21/h1-9,16,20H,10-13H2,(H,26,29)(H,27,30) |
| InChIKey | PJLGWEAOWDQWOV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |