C28H26N4O5 — CID 7051631
(4aR)-9-(1,3-benzodioxol-5-yl)-3-[4-(dimethylamino)benzoyl]-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione (PubChem CID 7051631) has the molecular formula C28H26N4O5 and a molecular weight of 498.54 g/mol. Its IUPAC name is (4aR)-9-(1,3-benzodioxol-5-yl)-3-[4-(dimethylamino)benzoyl]-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione.
| Compound Name | (4aR)-9-(1,3-benzodioxol-5-yl)-3-[4-(dimethylamino)benzoyl]-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione |
|---|---|
| PubChem CID | 7051631 |
| Molecular Formula | C28H26N4O5 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | (4aR)-9-(1,3-benzodioxol-5-yl)-3-[4-(dimethylamino)benzoyl]-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione |
| SMILES | CN(C)c1ccc(C(=O)N2CCN3C(=O)c4cc(-c5ccc6c(c5)OCO6)ccc4NC(=O)[C@H]3C2)cc1 |
| InChI | InChI=1S/C28H26N4O5/c1-30(2)20-7-3-17(4-8-20)27(34)31-11-12-32-23(15-31)26(33)29-22-9-5-18(13-21(22)28(32)35)19-6-10-24-25(14-19)37-16-36-24/h3-10,13-14,23H,11-12,15-16H2,1-2H3,(H,29,33)/t23-/m1/s1 |
| InChIKey | PILTZLJTPYDOFN-HSZRJFAPSA-N |
| XLogP | 3.07 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |