C24H18F3N3O4 — CID 11911610
(4aS)-9-(furan-2-yl)-3-[4-(trifluoromethyl)benzoyl]-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione (PubChem CID 11911610) has the molecular formula C24H18F3N3O4 and a molecular weight of 469.42 g/mol. Its IUPAC name is (4aS)-9-(furan-2-yl)-3-[4-(trifluoromethyl)benzoyl]-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione.
| Compound Name | (4aS)-9-(furan-2-yl)-3-[4-(trifluoromethyl)benzoyl]-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione |
|---|---|
| PubChem CID | 11911610 |
| Molecular Formula | C24H18F3N3O4 |
| Molecular Weight | 469.42 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | (4aS)-9-(furan-2-yl)-3-[4-(trifluoromethyl)benzoyl]-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione |
| SMILES | O=C1Nc2ccc(-c3ccco3)cc2C(=O)N2CCN(C(=O)c3ccc(C(F)(F)F)cc3)C[C@@H]12 |
| InChI | InChI=1S/C24H18F3N3O4/c25-24(26,27)16-6-3-14(4-7-16)22(32)29-9-10-30-19(13-29)21(31)28-18-8-5-15(12-17(18)23(30)33)20-2-1-11-34-20/h1-8,11-12,19H,9-10,13H2,(H,28,31)/t19-/m0/s1 |
| InChIKey | OLMSBWNPNKTRHL-IBGZPJMESA-N |
| XLogP | 3.88 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |