C28H25F3N4O3 — CID 7051636
(4aR)-3-[4-(dimethylamino)benzoyl]-9-[3-(trifluoromethyl)phenyl]-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione (PubChem CID 7051636) has the molecular formula C28H25F3N4O3 and a molecular weight of 522.53 g/mol. Its IUPAC name is (4aR)-3-[4-(dimethylamino)benzoyl]-9-[3-(trifluoromethyl)phenyl]-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione.
| Compound Name | (4aR)-3-[4-(dimethylamino)benzoyl]-9-[3-(trifluoromethyl)phenyl]-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione |
|---|---|
| PubChem CID | 7051636 |
| Molecular Formula | C28H25F3N4O3 |
| Molecular Weight | 522.53 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | (4aR)-3-[4-(dimethylamino)benzoyl]-9-[3-(trifluoromethyl)phenyl]-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione |
| SMILES | CN(C)c1ccc(C(=O)N2CCN3C(=O)c4cc(-c5cccc(C(F)(F)F)c5)ccc4NC(=O)[C@H]3C2)cc1 |
| InChI | InChI=1S/C28H25F3N4O3/c1-33(2)21-9-6-17(7-10-21)26(37)34-12-13-35-24(16-34)25(36)32-23-11-8-19(15-22(23)27(35)38)18-4-3-5-20(14-18)28(29,30)31/h3-11,14-15,24H,12-13,16H2,1-2H3,(H,32,36)/t24-/m1/s1 |
| InChIKey | STXRWJQLXALQCH-XMMPIXPASA-N |
| XLogP | 4.36 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |