C30H25F3N4O4 — CID 169133562
4-[2-[5,11-dioxo-9-[3-(trifluoromethyl)phenyl]-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepin-3-yl]-2-oxoethoxy]-3,5-dimethylbenzonitrile (PubChem CID 169133562) has the molecular formula C30H25F3N4O4 and a molecular weight of 562.55 g/mol. Its IUPAC name is 4-[2-[5,11-dioxo-9-[3-(trifluoromethyl)phenyl]-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepin-3-yl]-2-oxoethoxy]-3,5-dimethylbenzonitrile.
| Compound Name | 4-[2-[5,11-dioxo-9-[3-(trifluoromethyl)phenyl]-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepin-3-yl]-2-oxoethoxy]-3,5-dimethylbenzonitrile |
|---|---|
| PubChem CID | 169133562 |
| Molecular Formula | C30H25F3N4O4 |
| Molecular Weight | 562.55 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | 4-[2-[5,11-dioxo-9-[3-(trifluoromethyl)phenyl]-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepin-3-yl]-2-oxoethoxy]-3,5-dimethylbenzonitrile |
| SMILES | Cc1cc(C#N)cc(C)c1OCC(=O)N1CCN2C(=O)c3cc(-c4cccc(C(F)(F)F)c4)ccc3NC(=O)C2C1 |
| InChI | InChI=1S/C30H25F3N4O4/c1-17-10-19(14-34)11-18(2)27(17)41-16-26(38)36-8-9-37-25(15-36)28(39)35-24-7-6-21(13-23(24)29(37)40)20-4-3-5-22(12-20)30(31,32)33/h3-7,10-13,25H,8-9,15-16H2,1-2H3,(H,35,39) |
| InChIKey | WKYSHOAHLVUVOK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.55 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |