C29H23F6N3O5 — CID 169133605
3-[2-[2-methyl-4-(trifluoromethoxy)phenoxy]acetyl]-9-[3-(trifluoromethyl)phenyl]-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione (PubChem CID 169133605) has the molecular formula C29H23F6N3O5 and a molecular weight of 607.51 g/mol. Its IUPAC name is 3-[2-[2-methyl-4-(trifluoromethoxy)phenoxy]acetyl]-9-[3-(trifluoromethyl)phenyl]-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione.
| Compound Name | 3-[2-[2-methyl-4-(trifluoromethoxy)phenoxy]acetyl]-9-[3-(trifluoromethyl)phenyl]-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione |
|---|---|
| PubChem CID | 169133605 |
| Molecular Formula | C29H23F6N3O5 |
| Molecular Weight | 607.51 g/mol |
| Exact Mass | 607.15 |
| IUPAC Name | 3-[2-[2-methyl-4-(trifluoromethoxy)phenoxy]acetyl]-9-[3-(trifluoromethyl)phenyl]-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione |
| SMILES | Cc1cc(OC(F)(F)F)ccc1OCC(=O)N1CCN2C(=O)c3cc(-c4cccc(C(F)(F)F)c4)ccc3NC(=O)C2C1 |
| InChI | InChI=1S/C29H23F6N3O5/c1-16-11-20(43-29(33,34)35)6-8-24(16)42-15-25(39)37-9-10-38-23(14-37)26(40)36-22-7-5-18(13-21(22)27(38)41)17-3-2-4-19(12-17)28(30,31)32/h2-8,11-13,23H,9-10,14-15H2,1H3,(H,36,40) |
| InChIKey | PVTSWQQULVRABX-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.51 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |