C31H27F9N4O5 — CID 169133641
5-[3,5-bis(trifluoromethyl)phenyl]-13-[2-[2-methyl-4-(trifluoromethoxy)phenoxy]acetyl]-1,6,9,13-tetrazatricyclo[9.4.0.03,8]pentadeca-3,5,7-triene-2,10-dione;ethane (PubChem CID 169133641) has the molecular formula C31H27F9N4O5 and a molecular weight of 706.56 g/mol. Its IUPAC name is 5-[3,5-bis(trifluoromethyl)phenyl]-13-[2-[2-methyl-4-(trifluoromethoxy)phenoxy]acetyl]-1,6,9,13-tetrazatricyclo[9.4.0.03,8]pentadeca-3,5,7-triene-2,10-dione;ethane.
| Compound Name | 5-[3,5-bis(trifluoromethyl)phenyl]-13-[2-[2-methyl-4-(trifluoromethoxy)phenoxy]acetyl]-1,6,9,13-tetrazatricyclo[9.4.0.03,8]pentadeca-3,5,7-triene-2,10-dione;ethane |
|---|---|
| PubChem CID | 169133641 |
| Molecular Formula | C31H27F9N4O5 |
| Molecular Weight | 706.56 g/mol |
| Exact Mass | 706.18 |
| IUPAC Name | 5-[3,5-bis(trifluoromethyl)phenyl]-13-[2-[2-methyl-4-(trifluoromethoxy)phenoxy]acetyl]-1,6,9,13-tetrazatricyclo[9.4.0.03,8]pentadeca-3,5,7-triene-2,10-dione;ethane |
| SMILES | CC.Cc1cc(OC(F)(F)F)ccc1OCC(=O)N1CCN2C(=O)c3cc(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)ncc3NC(=O)C2C1 |
| InChI | InChI=1S/C29H21F9N4O5.C2H6/c1-14-6-18(47-29(36,37)38)2-3-23(14)46-13-24(43)41-4-5-42-22(12-41)25(44)40-21-11-39-20(10-19(21)26(42)45)15-7-16(27(30,31)32)9-17(8-15)28(33,34)35;1-2/h2-3,6-11,22H,4-5,12-13H2,1H3,(H,40,44);1-2H3 |
| InChIKey | IGKFMOVUFTXRRQ-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.56 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |