C28H18F9IN4O5 — CID 169133558
(11S)-5-[3,5-bis(trifluoromethyl)phenyl]-13-[2-[2-iodo-4-(trifluoromethoxy)phenoxy]acetyl]-1,6,9,13-tetrazatricyclo[9.4.0.03,8]pentadeca-3,5,7-triene-2,10-dione (PubChem CID 169133558) has the molecular formula C28H18F9IN4O5 and a molecular weight of 788.36 g/mol. Its IUPAC name is (11S)-5-[3,5-bis(trifluoromethyl)phenyl]-13-[2-[2-iodo-4-(trifluoromethoxy)phenoxy]acetyl]-1,6,9,13-tetrazatricyclo[9.4.0.03,8]pentadeca-3,5,7-triene-2,10-dione.
| Compound Name | (11S)-5-[3,5-bis(trifluoromethyl)phenyl]-13-[2-[2-iodo-4-(trifluoromethoxy)phenoxy]acetyl]-1,6,9,13-tetrazatricyclo[9.4.0.03,8]pentadeca-3,5,7-triene-2,10-dione |
|---|---|
| PubChem CID | 169133558 |
| Molecular Formula | C28H18F9IN4O5 |
| Molecular Weight | 788.36 g/mol |
| Exact Mass | 788.02 |
| IUPAC Name | (11S)-5-[3,5-bis(trifluoromethyl)phenyl]-13-[2-[2-iodo-4-(trifluoromethoxy)phenoxy]acetyl]-1,6,9,13-tetrazatricyclo[9.4.0.03,8]pentadeca-3,5,7-triene-2,10-dione |
| SMILES | O=C1Nc2cnc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)cc2C(=O)N2CCN(C(=O)COc3ccc(OC(F)(F)F)cc3I)C[C@@H]12 |
| InChI | InChI=1S/C28H18F9IN4O5/c29-26(30,31)14-5-13(6-15(7-14)27(32,33)34)19-9-17-20(10-39-19)40-24(44)21-11-41(3-4-42(21)25(17)45)23(43)12-46-22-2-1-16(8-18(22)38)47-28(35,36)37/h1-2,5-10,21H,3-4,11-12H2,(H,40,44)/t21-/m0/s1 |
| InChIKey | BLXDHRVCEBXGMA-NRFANRHFSA-N |
| XLogP | 5.97 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.36 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|