C26H21F3N4O3 — CID 3816654
5,11-dioxo-N-phenyl-9-[3-(trifluoromethyl)phenyl]-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-3-carboxamide (PubChem CID 3816654) has the molecular formula C26H21F3N4O3 and a molecular weight of 494.47 g/mol. Its IUPAC name is 5,11-dioxo-N-phenyl-9-[3-(trifluoromethyl)phenyl]-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-3-carboxamide.
| Compound Name | 5,11-dioxo-N-phenyl-9-[3-(trifluoromethyl)phenyl]-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-3-carboxamide |
|---|---|
| PubChem CID | 3816654 |
| Molecular Formula | C26H21F3N4O3 |
| Molecular Weight | 494.47 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 5,11-dioxo-N-phenyl-9-[3-(trifluoromethyl)phenyl]-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-3-carboxamide |
| SMILES | O=C1Nc2ccc(-c3cccc(C(F)(F)F)c3)cc2C(=O)N2CCN(C(=O)Nc3ccccc3)CC12 |
| InChI | InChI=1S/C26H21F3N4O3/c27-26(28,29)18-6-4-5-16(13-18)17-9-10-21-20(14-17)24(35)33-12-11-32(15-22(33)23(34)31-21)25(36)30-19-7-2-1-3-8-19/h1-10,13-14,22H,11-12,15H2,(H,30,36)(H,31,34) |
| InChIKey | YJTBTOWXAGRVJG-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |