C25H20F3N3O4 — CID 3288986
N-[2-(furan-2-yl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-4-(trifluoromethyl)benzamide (PubChem CID 3288986) has the molecular formula C25H20F3N3O4 and a molecular weight of 483.45 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-(furan-2-yl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 3288986 |
| Molecular Formula | C25H20F3N3O4 |
| Molecular Weight | 483.45 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | N-[2-(furan-2-yl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(NC1CCN2C(=O)c3cc(-c4ccco4)ccc3NC(=O)C2C1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H20F3N3O4/c26-25(27,28)16-6-3-14(4-7-16)22(32)29-17-9-10-31-20(13-17)23(33)30-19-8-5-15(12-18(19)24(31)34)21-2-1-11-35-21/h1-8,11-12,17,20H,9-10,13H2,(H,29,32)(H,30,33) |
| InChIKey | MQKAPMSSZQJBPF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.45 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |