C18H16BrN3O4 — CID 3496154
N-(2-bromo-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl)furan-2-carboxamide (PubChem CID 3496154) has the molecular formula C18H16BrN3O4 and a molecular weight of 418.25 g/mol. Its IUPAC name is N-(2-bromo-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl)furan-2-carboxamide.
| Compound Name | N-(2-bromo-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 3496154 |
| Molecular Formula | C18H16BrN3O4 |
| Molecular Weight | 418.25 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | N-(2-bromo-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl)furan-2-carboxamide |
| SMILES | O=C(NC1CCN2C(=O)c3cc(Br)ccc3NC(=O)C2C1)c1ccco1 |
| InChI | InChI=1S/C18H16BrN3O4/c19-10-3-4-13-12(8-10)18(25)22-6-5-11(9-14(22)16(23)21-13)20-17(24)15-2-1-7-26-15/h1-4,7-8,11,14H,5-6,9H2,(H,20,24)(H,21,23) |
| InChIKey | LSGIKBRBQSMLHN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |