C16H18BrN3O3S — CID 9424299
N-[(6aS,8S)-2-bromo-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-2-methylsulfanylacetamide (PubChem CID 9424299) has the molecular formula C16H18BrN3O3S and a molecular weight of 412.31 g/mol. Its IUPAC name is N-[(6aS,8S)-2-bromo-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-2-methylsulfanylacetamide.
| Compound Name | N-[(6aS,8S)-2-bromo-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-2-methylsulfanylacetamide |
|---|---|
| PubChem CID | 9424299 |
| Molecular Formula | C16H18BrN3O3S |
| Molecular Weight | 412.31 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | N-[(6aS,8S)-2-bromo-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-2-methylsulfanylacetamide |
| SMILES | CSCC(=O)N[C@H]1CCN2C(=O)c3cc(Br)ccc3NC(=O)[C@@H]2C1 |
| InChI | InChI=1S/C16H18BrN3O3S/c1-24-8-14(21)18-10-4-5-20-13(7-10)15(22)19-12-3-2-9(17)6-11(12)16(20)23/h2-3,6,10,13H,4-5,7-8H2,1H3,(H,18,21)(H,19,22)/t10-,13-/m0/s1 |
| InChIKey | ZKXRVWLAKFHHBC-GWCFXTLKSA-N |
| XLogP | 1.85 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |