C25H23N3O5 — CID 26763486
N-[(6aS,8S)-2-(4-methoxyphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]furan-2-carboxamide (PubChem CID 26763486) has the molecular formula C25H23N3O5 and a molecular weight of 445.48 g/mol. Its IUPAC name is N-[(6aS,8S)-2-(4-methoxyphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]furan-2-carboxamide.
| Compound Name | N-[(6aS,8S)-2-(4-methoxyphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 26763486 |
| Molecular Formula | C25H23N3O5 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | N-[(6aS,8S)-2-(4-methoxyphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]furan-2-carboxamide |
| SMILES | COc1ccc(-c2ccc3c(c2)C(=O)N2CC[C@H](NC(=O)c4ccco4)C[C@H]2C(=O)N3)cc1 |
| InChI | InChI=1S/C25H23N3O5/c1-32-18-7-4-15(5-8-18)16-6-9-20-19(13-16)25(31)28-11-10-17(14-21(28)23(29)27-20)26-24(30)22-3-2-12-33-22/h2-9,12-13,17,21H,10-11,14H2,1H3,(H,26,30)(H,27,29)/t17-,21-/m0/s1 |
| InChIKey | CMMSJIYCPLMQLY-UWJYYQICSA-N |
| XLogP | 3.31 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |