C28H24N4O5 — CID 5020360
2-amino-4-(furan-2-yl)-N-[2-(furan-2-yl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]benzamide (PubChem CID 5020360) has the molecular formula C28H24N4O5 and a molecular weight of 496.52 g/mol. Its IUPAC name is 2-amino-4-(furan-2-yl)-N-[2-(furan-2-yl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]benzamide.
| Compound Name | 2-amino-4-(furan-2-yl)-N-[2-(furan-2-yl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]benzamide |
|---|---|
| PubChem CID | 5020360 |
| Molecular Formula | C28H24N4O5 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 2-amino-4-(furan-2-yl)-N-[2-(furan-2-yl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]benzamide |
| SMILES | Nc1cc(-c2ccco2)ccc1C(=O)NC1CCN2C(=O)c3cc(-c4ccco4)ccc3NC(=O)C2C1 |
| InChI | InChI=1S/C28H24N4O5/c29-21-14-17(25-4-2-12-37-25)5-7-19(21)26(33)30-18-9-10-32-23(15-18)27(34)31-22-8-6-16(13-20(22)28(32)35)24-3-1-11-36-24/h1-8,11-14,18,23H,9-10,15,29H2,(H,30,33)(H,31,34) |
| InChIKey | BHDCSKKHGRSBAB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 130.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|