C18H16BrN3O4 — CID 3675744
N-[2-(4-bromophenyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]furan-2-carboxamide (PubChem CID 3675744) has the molecular formula C18H16BrN3O4 and a molecular weight of 418.25 g/mol. Its IUPAC name is N-[2-(4-bromophenyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]furan-2-carboxamide.
| Compound Name | N-[2-(4-bromophenyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3675744 |
| Molecular Formula | C18H16BrN3O4 |
| Molecular Weight | 418.25 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | N-[2-(4-bromophenyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]furan-2-carboxamide |
| SMILES | O=C(NC1CCN2C(=O)N(c3ccc(Br)cc3)C(=O)C2C1)c1ccco1 |
| InChI | InChI=1S/C18H16BrN3O4/c19-11-3-5-13(6-4-11)22-17(24)14-10-12(7-8-21(14)18(22)25)20-16(23)15-2-1-9-26-15/h1-6,9,12,14H,7-8,10H2,(H,20,23) |
| InChIKey | BOWWVJZOCRCJCF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.25 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|