C22H24N4O3 — CID 163072708
N-[(7S,8aR)-1,3-dioxo-2-(4-propan-2-ylphenyl)-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]pyridine-4-carboxamide (PubChem CID 163072708) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is N-[(7S,8aR)-1,3-dioxo-2-(4-propan-2-ylphenyl)-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]pyridine-4-carboxamide.
| Compound Name | N-[(7S,8aR)-1,3-dioxo-2-(4-propan-2-ylphenyl)-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 163072708 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | N-[(7S,8aR)-1,3-dioxo-2-(4-propan-2-ylphenyl)-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]pyridine-4-carboxamide |
| SMILES | CC(C)c1ccc(N2C(=O)[C@H]3C[C@@H](NC(=O)c4ccncc4)CCN3C2=O)cc1 |
| InChI | InChI=1S/C22H24N4O3/c1-14(2)15-3-5-18(6-4-15)26-21(28)19-13-17(9-12-25(19)22(26)29)24-20(27)16-7-10-23-11-8-16/h3-8,10-11,14,17,19H,9,12-13H2,1-2H3,(H,24,27)/t17-,19+/m0/s1 |
| InChIKey | XQWLLMHTNXTPIZ-PKOBYXMFSA-N |
| XLogP | 2.93 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|