C15H18N4O3 — CID 3749820
N-(2-methyl-1,4-dioxo-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazin-8-yl)pyridine-4-carboxamide (PubChem CID 3749820) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is N-(2-methyl-1,4-dioxo-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazin-8-yl)pyridine-4-carboxamide.
| Compound Name | N-(2-methyl-1,4-dioxo-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazin-8-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 3749820 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | N-(2-methyl-1,4-dioxo-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazin-8-yl)pyridine-4-carboxamide |
| SMILES | CN1CC(=O)N2CCC(NC(=O)c3ccncc3)CC2C1=O |
| InChI | InChI=1S/C15H18N4O3/c1-18-9-13(20)19-7-4-11(8-12(19)15(18)22)17-14(21)10-2-5-16-6-3-10/h2-3,5-6,11-12H,4,7-9H2,1H3,(H,17,21) |
| InChIKey | MJDIVPNHGAASIU-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |