C21H21ClN4O5 — CID 162807827
N-[(7S,8aR)-2-(3,5-dimethoxyphenyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]-2-chloropyridine-4-carboxamide (PubChem CID 162807827) has the molecular formula C21H21ClN4O5 and a molecular weight of 444.88 g/mol. Its IUPAC name is N-[(7S,8aR)-2-(3,5-dimethoxyphenyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]-2-chloropyridine-4-carboxamide.
| Compound Name | N-[(7S,8aR)-2-(3,5-dimethoxyphenyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]-2-chloropyridine-4-carboxamide |
|---|---|
| PubChem CID | 162807827 |
| Molecular Formula | C21H21ClN4O5 |
| Molecular Weight | 444.88 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | N-[(7S,8aR)-2-(3,5-dimethoxyphenyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]-2-chloropyridine-4-carboxamide |
| SMILES | COc1cc(OC)cc(N2C(=O)[C@H]3C[C@@H](NC(=O)c4ccnc(Cl)c4)CCN3C2=O)c1 |
| InChI | InChI=1S/C21H21ClN4O5/c1-30-15-9-14(10-16(11-15)31-2)26-20(28)17-8-13(4-6-25(17)21(26)29)24-19(27)12-3-5-23-18(22)7-12/h3,5,7,9-11,13,17H,4,6,8H2,1-2H3,(H,24,27)/t13-,17+/m0/s1 |
| InChIKey | OYCJAAGUMJYSMT-SUMWQHHRSA-N |
| XLogP | 2.48 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.88 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|