C19H21Cl2N3O3 — CID 74509211
N-[2-(3,4-dichlorophenyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]cyclopentanecarboxamide (PubChem CID 74509211) has the molecular formula C19H21Cl2N3O3 and a molecular weight of 410.30 g/mol. Its IUPAC name is N-[2-(3,4-dichlorophenyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]cyclopentanecarboxamide.
| Compound Name | N-[2-(3,4-dichlorophenyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 74509211 |
| Molecular Formula | C19H21Cl2N3O3 |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | N-[2-(3,4-dichlorophenyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]cyclopentanecarboxamide |
| SMILES | O=C(NC1CCN2C(=O)N(c3ccc(Cl)c(Cl)c3)C(=O)C2C1)C1CCCC1 |
| InChI | InChI=1S/C19H21Cl2N3O3/c20-14-6-5-13(10-15(14)21)24-18(26)16-9-12(7-8-23(16)19(24)27)22-17(25)11-3-1-2-4-11/h5-6,10-12,16H,1-4,7-9H2,(H,22,25) |
| InChIKey | NHKXEOHAABEBRM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|