C22H25F3N4O4 — CID 7050302
1-acetyl-N-[(7S,8aS)-1,3-dioxo-2-[3-(trifluoromethyl)phenyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]piperidine-4-carboxamide (PubChem CID 7050302) has the molecular formula C22H25F3N4O4 and a molecular weight of 466.46 g/mol. Its IUPAC name is 1-acetyl-N-[(7S,8aS)-1,3-dioxo-2-[3-(trifluoromethyl)phenyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]piperidine-4-carboxamide.
| Compound Name | 1-acetyl-N-[(7S,8aS)-1,3-dioxo-2-[3-(trifluoromethyl)phenyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 7050302 |
| Molecular Formula | C22H25F3N4O4 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 1-acetyl-N-[(7S,8aS)-1,3-dioxo-2-[3-(trifluoromethyl)phenyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]piperidine-4-carboxamide |
| SMILES | CC(=O)N1CCC(C(=O)N[C@H]2CCN3C(=O)N(c4cccc(C(F)(F)F)c4)C(=O)[C@@H]3C2)CC1 |
| InChI | InChI=1S/C22H25F3N4O4/c1-13(30)27-8-5-14(6-9-27)19(31)26-16-7-10-28-18(12-16)20(32)29(21(28)33)17-4-2-3-15(11-17)22(23,24)25/h2-4,11,14,16,18H,5-10,12H2,1H3,(H,26,31)/t16-,18-/m0/s1 |
| InChIKey | DFNRGLXATJSZAY-WMZOPIPTSA-N |
| XLogP | 2.38 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|