C21H25ClN4O4 — CID 7050303
1-acetyl-N-[(7S,8aS)-2-(4-chlorophenyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]piperidine-4-carboxamide (PubChem CID 7050303) has the molecular formula C21H25ClN4O4 and a molecular weight of 432.91 g/mol. Its IUPAC name is 1-acetyl-N-[(7S,8aS)-2-(4-chlorophenyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]piperidine-4-carboxamide.
| Compound Name | 1-acetyl-N-[(7S,8aS)-2-(4-chlorophenyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 7050303 |
| Molecular Formula | C21H25ClN4O4 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 1-acetyl-N-[(7S,8aS)-2-(4-chlorophenyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]piperidine-4-carboxamide |
| SMILES | CC(=O)N1CCC(C(=O)N[C@H]2CCN3C(=O)N(c4ccc(Cl)cc4)C(=O)[C@@H]3C2)CC1 |
| InChI | InChI=1S/C21H25ClN4O4/c1-13(27)24-9-6-14(7-10-24)19(28)23-16-8-11-25-18(12-16)20(29)26(21(25)30)17-4-2-15(22)3-5-17/h2-5,14,16,18H,6-12H2,1H3,(H,23,28)/t16-,18-/m0/s1 |
| InChIKey | PZTAQGVPLKFPRD-WMZOPIPTSA-N |
| XLogP | 2.01 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|