C21H19ClFN3O3S — CID 3362296
3-chloro-4-fluoro-N-[2-(3-methylsulfanylphenyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]benzamide (PubChem CID 3362296) has the molecular formula C21H19ClFN3O3S and a molecular weight of 447.92 g/mol. Its IUPAC name is 3-chloro-4-fluoro-N-[2-(3-methylsulfanylphenyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]benzamide.
| Compound Name | 3-chloro-4-fluoro-N-[2-(3-methylsulfanylphenyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]benzamide |
|---|---|
| PubChem CID | 3362296 |
| Molecular Formula | C21H19ClFN3O3S |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | 3-chloro-4-fluoro-N-[2-(3-methylsulfanylphenyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]benzamide |
| SMILES | CSc1cccc(N2C(=O)C3CC(NC(=O)c4ccc(F)c(Cl)c4)CCN3C2=O)c1 |
| InChI | InChI=1S/C21H19ClFN3O3S/c1-30-15-4-2-3-14(11-15)26-20(28)18-10-13(7-8-25(18)21(26)29)24-19(27)12-5-6-17(23)16(22)9-12/h2-6,9,11,13,18H,7-8,10H2,1H3,(H,24,27) |
| InChIKey | PBYOGSHICGZHBA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|