C19H18ClN3O5 — CID 7051204
N-[(7S,8aS)-2-(5-chloro-2-methoxyphenyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]furan-2-carboxamide (PubChem CID 7051204) has the molecular formula C19H18ClN3O5 and a molecular weight of 403.82 g/mol. Its IUPAC name is N-[(7S,8aS)-2-(5-chloro-2-methoxyphenyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]furan-2-carboxamide.
| Compound Name | N-[(7S,8aS)-2-(5-chloro-2-methoxyphenyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 7051204 |
| Molecular Formula | C19H18ClN3O5 |
| Molecular Weight | 403.82 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | N-[(7S,8aS)-2-(5-chloro-2-methoxyphenyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]furan-2-carboxamide |
| SMILES | COc1ccc(Cl)cc1N1C(=O)[C@@H]2C[C@@H](NC(=O)c3ccco3)CCN2C1=O |
| InChI | InChI=1S/C19H18ClN3O5/c1-27-15-5-4-11(20)9-13(15)23-18(25)14-10-12(6-7-22(14)19(23)26)21-17(24)16-3-2-8-28-16/h2-5,8-9,12,14H,6-7,10H2,1H3,(H,21,24)/t12-,14-/m0/s1 |
| InChIKey | CGQRGPGNUMQCNP-JSGCOSHPSA-N |
| XLogP | 2.67 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.82 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|