C20H14ClNO5 — CID 98225230
[4-chloro-2-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl] furan-2-carboxylate (PubChem CID 98225230) has the molecular formula C20H14ClNO5 and a molecular weight of 383.79 g/mol. Its IUPAC name is [4-chloro-2-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl] furan-2-carboxylate.
| Compound Name | [4-chloro-2-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 98225230 |
| Molecular Formula | C20H14ClNO5 |
| Molecular Weight | 383.79 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | [4-chloro-2-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl] furan-2-carboxylate |
| SMILES | O=C(Oc1ccc(Cl)cc1N1C(=O)[C@@H]2[C@H](C1=O)[C@H]1C=C[C@H]2C1)c1ccco1 |
| InChI | InChI=1S/C20H14ClNO5/c21-12-5-6-14(27-20(25)15-2-1-7-26-15)13(9-12)22-18(23)16-10-3-4-11(8-10)17(16)19(22)24/h1-7,9-11,16-17H,8H2/t10-,11-,16-,17+/m0/s1 |
| InChIKey | DIVGLJMSDGOVKY-NXKWAJLKSA-N |
| XLogP | 3.46 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.79 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|