C14H11NO5 — CID 124578412
[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl] furan-2-carboxylate (PubChem CID 124578412) has the molecular formula C14H11NO5 and a molecular weight of 273.24 g/mol. Its IUPAC name is [(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl] furan-2-carboxylate.
| Compound Name | [(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 124578412 |
| Molecular Formula | C14H11NO5 |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | [(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl] furan-2-carboxylate |
| SMILES | O=C(ON1C(=O)[C@@H]2[C@H](C1=O)[C@H]1C=C[C@H]2C1)c1ccco1 |
| InChI | InChI=1S/C14H11NO5/c16-12-10-7-3-4-8(6-7)11(10)13(17)15(12)20-14(18)9-2-1-5-19-9/h1-5,7-8,10-11H,6H2/t7-,8-,10-,11+/m0/s1 |
| InChIKey | NNIJJCYPTBOVEC-MPKXCIJOSA-N |
| XLogP | 1.16 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|