C21H25N3O5 — CID 44516170
(1R,7S)-4-[3-[4-(furan-2-carbonyl)piperazin-1-yl]propoxy]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 44516170) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is (1R,7S)-4-[3-[4-(furan-2-carbonyl)piperazin-1-yl]propoxy]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,7S)-4-[3-[4-(furan-2-carbonyl)piperazin-1-yl]propoxy]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 44516170 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | (1R,7S)-4-[3-[4-(furan-2-carbonyl)piperazin-1-yl]propoxy]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C(c1ccco1)N1CCN(CCCON2C(=O)C3C(C2=O)[C@H]2C=C[C@@H]3C2)CC1 |
| InChI | InChI=1S/C21H25N3O5/c25-19(16-3-1-11-28-16)23-9-7-22(8-10-23)6-2-12-29-24-20(26)17-14-4-5-15(13-14)18(17)21(24)27/h1,3-5,11,14-15,17-18H,2,6-10,12-13H2/t14-,15+,17?,18? |
| InChIKey | BFWXOOVENAUXEB-BXXOZEPKSA-N |
| XLogP | 1.17 |
| TPSA | 83.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|