C18H19N2O5- — CID 18557845
(1S,2S,3R,4S)-3-[4-(furan-2-carbonyl)piperazine-1-carbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 18557845) has the molecular formula C18H19N2O5- and a molecular weight of 343.36 g/mol. Its IUPAC name is (1S,2S,3R,4S)-3-[4-(furan-2-carbonyl)piperazine-1-carbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (1S,2S,3R,4S)-3-[4-(furan-2-carbonyl)piperazine-1-carbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 18557845 |
| Molecular Formula | C18H19N2O5- |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | (1S,2S,3R,4S)-3-[4-(furan-2-carbonyl)piperazine-1-carbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C([O-])[C@@H]1[C@H](C(=O)N2CCN(C(=O)c3ccco3)CC2)[C@@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C18H20N2O5/c21-16(13-2-1-9-25-13)19-5-7-20(8-6-19)17(22)14-11-3-4-12(10-11)15(14)18(23)24/h1-4,9,11-12,14-15H,5-8,10H2,(H,23,24)/p-1/t11-,12-,14-,15+/m1/s1 |
| InChIKey | CVFJKTXJTUYOLX-GBOPCIDUSA-M |
| XLogP | -0.25 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|