C21H26N2O4 — CID 18557663
(1S,2S,3R,4S)-3-[4-[(3-methoxyphenyl)methyl]piperazin-4-ium-1-carbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 18557663) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is (1S,2S,3R,4S)-3-[4-[(3-methoxyphenyl)methyl]piperazin-4-ium-1-carbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (1S,2S,3R,4S)-3-[4-[(3-methoxyphenyl)methyl]piperazin-4-ium-1-carbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 18557663 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | (1S,2S,3R,4S)-3-[4-[(3-methoxyphenyl)methyl]piperazin-4-ium-1-carbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | COc1cccc(C[NH+]2CCN(C(=O)[C@H]3[C@@H](C(=O)[O-])[C@@H]4C=C[C@@H]3C4)CC2)c1 |
| InChI | InChI=1S/C21H26N2O4/c1-27-17-4-2-3-14(11-17)13-22-7-9-23(10-8-22)20(24)18-15-5-6-16(12-15)19(18)21(25)26/h2-6,11,15-16,18-19H,7-10,12-13H2,1H3,(H,25,26)/t15-,16-,18-,19+/m1/s1 |
| InChIKey | QPWGHFYPCHTRPZ-RWQQGDIJSA-N |
| XLogP | -0.89 |
| TPSA | 74.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|