C16H14NO5- — CID 5152518
3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(furan-2-yl)propanoate (PubChem CID 5152518) has the molecular formula C16H14NO5- and a molecular weight of 300.29 g/mol. Its IUPAC name is 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(furan-2-yl)propanoate.
| Compound Name | 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(furan-2-yl)propanoate |
|---|---|
| PubChem CID | 5152518 |
| Molecular Formula | C16H14NO5- |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(furan-2-yl)propanoate |
| SMILES | O=C([O-])CC(c1ccco1)N1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C16H15NO5/c18-12(19)7-10(11-2-1-5-22-11)17-15(20)13-8-3-4-9(6-8)14(13)16(17)21/h1-5,8-10,13-14H,6-7H2,(H,18,19)/p-1 |
| InChIKey | LBQJCSNPNIVDQG-UHFFFAOYSA-M |
| XLogP | 0.27 |
| TPSA | 90.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|