C14H5Cl6NO5 — CID 99947876
[(1R,2R,6R,7R)-1,7,8,9,10,10-hexachloro-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl] furan-2-carboxylate (PubChem CID 99947876) has the molecular formula C14H5Cl6NO5 and a molecular weight of 479.91 g/mol. Its IUPAC name is [(1R,2R,6R,7R)-1,7,8,9,10,10-hexachloro-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl] furan-2-carboxylate.
| Compound Name | [(1R,2R,6R,7R)-1,7,8,9,10,10-hexachloro-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 99947876 |
| Molecular Formula | C14H5Cl6NO5 |
| Molecular Weight | 479.91 g/mol |
| Exact Mass | 476.83 |
| IUPAC Name | [(1R,2R,6R,7R)-1,7,8,9,10,10-hexachloro-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl] furan-2-carboxylate |
| SMILES | O=C(ON1C(=O)[C@H]2[C@H](C1=O)[C@@]1(Cl)C(Cl)=C(Cl)[C@@]2(Cl)C1(Cl)Cl)c1ccco1 |
| InChI | InChI=1S/C14H5Cl6NO5/c15-7-8(16)13(18)6-5(12(7,17)14(13,19)20)9(22)21(10(6)23)26-11(24)4-2-1-3-25-4/h1-3,5-6H/t5-,6-,12-,13-/m1/s1 |
| InChIKey | FMDOFMFCGJITDK-DOAZQSFWSA-N |
| XLogP | 3.80 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.91 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|